About tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate
tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate (PubChem CID 90840537) has the molecular formula C13H21N3O6
and a molecular weight of 315.33 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate |
| PubChem CID | 90840537 |
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate |
| SMILES | C[C@H](CNC(=O)On1c(O)ccc1O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21N3O6/c1-8(15-12(20)21-13(2,3)4)7-14-11(19)22-16-9(17)5-6-10(16)18/h5-6,8,17-18H,7H2,1-4H3,(H,14,19)(H,15,20)/t8-/m1/s1 |
| InChIKey | JNOMFGJFPHFRTJ-MRVPVSSYSA-N |
| XLogP | 0.95 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate (CID 90840537) is tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate is C[C@H](CNC(=O)On1c(O)ccc1O)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate?
The InChIKey is JNOMFGJFPHFRTJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C13H21N3O6/c1-8(15-12(20)21-13(2,3)4)7-14-11(19)22-16-9(17)5-6-10(16)18/h5-6,8,17-18H,7H2,1-4H3,(H,14,19)(H,15,20)/t8-/m1/s1.
What are the key properties of tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate?
tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate has a molecular weight of 315.33 g/mol, XLogP of 0.95, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2R)-1-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]propan-2-yl]carbamate is sourced from PubChem (CID 90840537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).