About 7-ethyl-1H-isochromene
7-ethyl-1H-isochromene (PubChem CID 90840835) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 7-ethyl-1H-isochromene.
Molecular Properties
| Compound Name | 7-ethyl-1H-isochromene |
| PubChem CID | 90840835 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 7-ethyl-1H-isochromene |
| SMILES | CCc1ccc2c(c1)COC=C2 |
| InChI | InChI=1S/C11H12O/c1-2-9-3-4-10-5-6-12-8-11(10)7-9/h3-7H,2,8H2,1H3 |
| InChIKey | VTTHWFSKCVGHNC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethyl-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1H-isochromene?
The IUPAC name of 7-ethyl-1H-isochromene (CID 90840835) is 7-ethyl-1H-isochromene.
What is the SMILES notation for 7-ethyl-1H-isochromene?
The canonical SMILES for 7-ethyl-1H-isochromene is CCc1ccc2c(c1)COC=C2.
What is the InChIKey of 7-ethyl-1H-isochromene?
The InChIKey is VTTHWFSKCVGHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-2-9-3-4-10-5-6-12-8-11(10)7-9/h3-7H,2,8H2,1H3.
What are the key properties of 7-ethyl-1H-isochromene?
7-ethyl-1H-isochromene has a molecular weight of 160.22 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1H-isochromene is sourced from PubChem (CID 90840835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).