C12H20F3NO+2 — CID 90840966
[(1Z,3Z)-2-butan-2-yl-6,6,6-trifluoro-5-methylhexa-1,3-dienyl]-methoxyazanium (PubChem CID 90840966) has the molecular formula C12H20F3NO+2 and a molecular weight of 251.29 g/mol. Its IUPAC name is [(1Z,3Z)-2-butan-2-yl-6,6,6-trifluoro-5-methylhexa-1,3-dienyl]-methoxyazanium.
| Compound Name | [(1Z,3Z)-2-butan-2-yl-6,6,6-trifluoro-5-methylhexa-1,3-dienyl]-methoxyazanium |
|---|---|
| PubChem CID | 90840966 |
| Molecular Formula | C12H20F3NO+2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [(1Z,3Z)-2-butan-2-yl-6,6,6-trifluoro-5-methylhexa-1,3-dienyl]-methoxyazanium |
| SMILES | [CH2+]C(/C=C\C(=C/[NH2+]OC)C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C12H19F3NO/c1-5-9(2)11(8-16-17-4)7-6-10(3)12(13,14)15/h6-10,16H,3,5H2,1-2,4H3/q+1/p+1/b7-6-,11-8+ |
| InChIKey | HAACMIIXNMPSRF-BQGCWICQSA-O |
| XLogP | 2.61 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|