C14H12F6N2O10S2 — CID 90841167
[1,3,5,7-tetrahydroxy-2-(2,2,2-trifluoroethylsulfonyloxy)-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,2,2-trifluoroethanesulfonate (PubChem CID 90841167) has the molecular formula C14H12F6N2O10S2 and a molecular weight of 546.38 g/mol. Its IUPAC name is [1,3,5,7-tetrahydroxy-2-(2,2,2-trifluoroethylsulfonyloxy)-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,2,2-trifluoroethanesulfonate.
| Compound Name | [1,3,5,7-tetrahydroxy-2-(2,2,2-trifluoroethylsulfonyloxy)-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 90841167 |
| Molecular Formula | C14H12F6N2O10S2 |
| Molecular Weight | 546.38 g/mol |
| Exact Mass | 545.98 |
| IUPAC Name | [1,3,5,7-tetrahydroxy-2-(2,2,2-trifluoroethylsulfonyloxy)-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)(CC(F)(F)F)On1c(O)c2c(c1O)Cc1c(c(O)n(OS(=O)(=O)CC(F)(F)F)c1O)C2 |
| InChI | InChI=1S/C14H12F6N2O10S2/c15-13(16,17)3-33(27,28)31-21-9(23)5-1-6-8(2-7(5)11(21)25)12(26)22(10(6)24)32-34(29,30)4-14(18,19)20/h23-26H,1-4H2 |
| InChIKey | SMQWGQGMMZWYKG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |