C43H51N3O9 — CID 90841741
3-[4-methoxy-3-[8-[2-methoxy-4-(6-methoxy-1,2,3,4-tetrahydroquinazolin-2-yl)phenoxy]octoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 90841741) has the molecular formula C43H51N3O9 and a molecular weight of 753.89 g/mol. Its IUPAC name is 3-[4-methoxy-3-[8-[2-methoxy-4-(6-methoxy-1,2,3,4-tetrahydroquinazolin-2-yl)phenoxy]octoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole.
| Compound Name | 3-[4-methoxy-3-[8-[2-methoxy-4-(6-methoxy-1,2,3,4-tetrahydroquinazolin-2-yl)phenoxy]octoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 90841741 |
| Molecular Formula | C43H51N3O9 |
| Molecular Weight | 753.89 g/mol |
| Exact Mass | 753.36 |
| IUPAC Name | 3-[4-methoxy-3-[8-[2-methoxy-4-(6-methoxy-1,2,3,4-tetrahydroquinazolin-2-yl)phenoxy]octoxy]phenyl]-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1ccc2c(c1)CNC(c1ccc(OCCCCCCCCOc3cc(-c4cc(-c5cc(OC)c(OC)c(OC)c5)on4)ccc3OC)c(OC)c1)N2 |
| InChI | InChI=1S/C43H51N3O9/c1-47-32-15-16-33-31(21-32)27-44-43(45-33)29-14-18-36(38(23-29)49-3)53-19-11-9-7-8-10-12-20-54-39-22-28(13-17-35(39)48-2)34-26-37(55-46-34)30-24-40(50-4)42(52-6)41(25-30)51-5/h13-18,21-26,43-45H,7-12,19-20,27H2,1-6H3 |
| InChIKey | UWTRNPLDVGVRBV-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.89 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|