About but-3-en-2-ylideneurea
but-3-en-2-ylideneurea (PubChem CID 90842412) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is but-3-en-2-ylideneurea.
Molecular Properties
| Compound Name | but-3-en-2-ylideneurea |
| PubChem CID | 90842412 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | but-3-en-2-ylideneurea |
| SMILES | C=CC(C)=NC(N)=O |
| InChI | InChI=1S/C5H8N2O/c1-3-4(2)7-5(6)8/h3H,1H2,2H3,(H2,6,8) |
| InChIKey | ZLTIFZKONVIFPI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-ylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-ylideneurea?
The IUPAC name of but-3-en-2-ylideneurea (CID 90842412) is but-3-en-2-ylideneurea.
What is the SMILES notation for but-3-en-2-ylideneurea?
The canonical SMILES for but-3-en-2-ylideneurea is C=CC(C)=NC(N)=O.
What is the InChIKey of but-3-en-2-ylideneurea?
The InChIKey is ZLTIFZKONVIFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-3-4(2)7-5(6)8/h3H,1H2,2H3,(H2,6,8).
What are the key properties of but-3-en-2-ylideneurea?
but-3-en-2-ylideneurea has a molecular weight of 112.13 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-ylideneurea is sourced from PubChem (CID 90842412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).