C45H82O12 — CID 90842842
2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene;8-methyl-2-(prop-1-en-2-yloxymethoxymethyl)non-8-en-1-ol (PubChem CID 90842842) has the molecular formula C45H82O12 and a molecular weight of 815.14 g/mol. Its IUPAC name is 2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene;8-methyl-2-(prop-1-en-2-yloxymethoxymethyl)non-8-en-1-ol.
| Compound Name | 2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene;8-methyl-2-(prop-1-en-2-yloxymethoxymethyl)non-8-en-1-ol |
|---|---|
| PubChem CID | 90842842 |
| Molecular Formula | C45H82O12 |
| Molecular Weight | 815.14 g/mol |
| Exact Mass | 814.58 |
| IUPAC Name | 2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene;8-methyl-2-(prop-1-en-2-yloxymethoxymethyl)non-8-en-1-ol |
| SMILES | C=C(C)CCCCCC(CO)COCOC(=C)C.C=C(C)CCCCCC(COCCOCOC(=C)C)(COCCOCOC(=C)C)COCCOCOC(=C)C |
| InChI | InChI=1S/C30H54O9.C15H28O3/c1-26(2)12-10-9-11-13-30(20-31-14-17-34-23-37-27(3)4,21-32-15-18-35-24-38-28(5)6)22-33-16-19-36-25-39-29(7)8;1-13(2)8-6-5-7-9-15(10-16)11-17-12-18-14(3)4/h1,3,5,7,9-25H2,2,4,6,8H3;15-16H,1,3,5-12H2,2,4H3 |
| InChIKey | RHZQPRHONSPELJ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.14 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|