C20H23NO2 — CID 90843850
(1R,7S,8S,10R)-4-(4-propan-2-ylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol (PubChem CID 90843850) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (1R,7S,8S,10R)-4-(4-propan-2-ylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol.
| Compound Name | (1R,7S,8S,10R)-4-(4-propan-2-ylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 90843850 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (1R,7S,8S,10R)-4-(4-propan-2-ylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
| SMILES | CC(C)c1ccc(-n2c(O)c3c(c2O)[C@@H]2CC[C@H]3[C@H]3C[C@H]32)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-10(2)11-3-5-12(6-4-11)21-19(22)17-13-7-8-14(16-9-15(13)16)18(17)20(21)23/h3-6,10,13-16,22-23H,7-9H2,1-2H3/t13-,14+,15+,16- |
| InChIKey | IBDFORVOBXDKGM-SYMSYNOKSA-N |
| XLogP | 4.62 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |