About 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate
3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate (PubChem CID 90844099) has the molecular formula C19H27NO6
and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate |
| PubChem CID | 90844099 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate |
| SMILES | CCOC(=O)CC.COc1ccc(C2=NOC3(CCOC3)C2)cc1OC |
| InChI | InChI=1S/C14H17NO4.C5H10O2/c1-16-12-4-3-10(7-13(12)17-2)11-8-14(19-15-11)5-6-18-9-14;1-3-5(6)7-4-2/h3-4,7H,5-6,8-9H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | ALEOZZXFQUWMNV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate (CID 90844099) is 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate is CCOC(=O)CC.COc1ccc(C2=NOC3(CCOC3)C2)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate?
The InChIKey is ALEOZZXFQUWMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4.C5H10O2/c1-16-12-4-3-10(7-13(12)17-2)11-8-14(19-15-11)5-6-18-9-14;1-3-5(6)7-4-2/h3-4,7H,5-6,8-9H2,1-2H3;3-4H2,1-2H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate?
3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate has a molecular weight of 365.43 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene;ethyl propanoate is sourced from PubChem (CID 90844099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).