C26H36FN3O5 — CID 90844301
2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol (PubChem CID 90844301) has the molecular formula C26H36FN3O5 and a molecular weight of 489.59 g/mol. Its IUPAC name is 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol.
| Compound Name | 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
|---|---|
| PubChem CID | 90844301 |
| Molecular Formula | C26H36FN3O5 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
| SMILES | Oc1c2c(c(O)n1CCCN1CCN(c3cc(F)ccc3OC3CCCC3)CC1)CC(O)C(O)C2 |
| InChI | InChI=1S/C26H36FN3O5/c27-17-6-7-24(35-18-4-1-2-5-18)21(14-17)29-12-10-28(11-13-29)8-3-9-30-25(33)19-15-22(31)23(32)16-20(19)26(30)34/h6-7,14,18,22-23,31-34H,1-5,8-13,15-16H2 |
| InChIKey | ITYFDAJVEPRCGU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |