C26H29FN4O4 — CID 90844646
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(3-fluoro-4-hydroxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 90844646) has the molecular formula C26H29FN4O4 and a molecular weight of 480.54 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(3-fluoro-4-hydroxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(3-fluoro-4-hydroxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 90844646 |
| Molecular Formula | C26H29FN4O4 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(3-fluoro-4-hydroxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(CCc4ccc(O)c(F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C26H29FN4O4/c1-15-11-16(2)31-25(28-15)29-23(30-31)13-19-22(33)14-26(35-24(19)34,18-5-3-4-6-18)10-9-17-7-8-21(32)20(27)12-17/h7-8,11-12,18-19,32H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | PUYMTBDNYVTJOL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|