C11H8N2O — CID 90844750
1,7-dihydropyrrolo[2,3-h]quinolin-2-one (PubChem CID 90844750) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is 1,7-dihydropyrrolo[2,3-h]quinolin-2-one.
| Compound Name | 1,7-dihydropyrrolo[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 90844750 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 1,7-dihydropyrrolo[2,3-h]quinolin-2-one |
| SMILES | O=c1ccc2ccc3[nH]ccc3c2[nH]1 |
| InChI | InChI=1S/C11H8N2O/c14-10-4-2-7-1-3-9-8(5-6-12-9)11(7)13-10/h1-6,12H,(H,13,14) |
| InChIKey | OUBOCOWYGJLGFN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |