C27H18F3N5O — CID 90845210
3-(1H-pyrrol-2-ylmethylidene)-6-[[2-[3-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]amino]-1H-indol-2-one (PubChem CID 90845210) has the molecular formula C27H18F3N5O and a molecular weight of 485.47 g/mol. Its IUPAC name is 3-(1H-pyrrol-2-ylmethylidene)-6-[[2-[3-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]amino]-1H-indol-2-one.
| Compound Name | 3-(1H-pyrrol-2-ylmethylidene)-6-[[2-[3-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]amino]-1H-indol-2-one |
|---|---|
| PubChem CID | 90845210 |
| Molecular Formula | C27H18F3N5O |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-(1H-pyrrol-2-ylmethylidene)-6-[[2-[3-(trifluoromethyl)phenyl]-3H-benzimidazol-5-yl]amino]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Nc3ccc4nc(-c5cccc(C(F)(F)F)c5)[nH]c4c3)ccc2C1=Cc1ccc[nH]1 |
| InChI | InChI=1S/C27H18F3N5O/c28-27(29,30)16-4-1-3-15(11-16)25-33-22-9-7-19(14-24(22)34-25)32-18-6-8-20-21(12-17-5-2-10-31-17)26(36)35-23(20)13-18/h1-14,31-32H,(H,33,34)(H,35,36) |
| InChIKey | JAARTMUCIMVESM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|