C25H25N5O7S2 — CID 90845281
(2R)-N-[1-(1,3-benzoxazol-2-yl)-1-oxopentan-2-yl]-3-benzylsulfonyl-2-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide (PubChem CID 90845281) has the molecular formula C25H25N5O7S2 and a molecular weight of 571.64 g/mol. Its IUPAC name is (2R)-N-[1-(1,3-benzoxazol-2-yl)-1-oxopentan-2-yl]-3-benzylsulfonyl-2-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide.
| Compound Name | (2R)-N-[1-(1,3-benzoxazol-2-yl)-1-oxopentan-2-yl]-3-benzylsulfonyl-2-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 90845281 |
| Molecular Formula | C25H25N5O7S2 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | (2R)-N-[1-(1,3-benzoxazol-2-yl)-1-oxopentan-2-yl]-3-benzylsulfonyl-2-[(5-nitro-1,3-thiazol-2-yl)amino]propanamide |
| SMILES | CCCC(NC(=O)[C@H](CS(=O)(=O)Cc1ccccc1)Nc1ncc([N+](=O)[O-])s1)C(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C25H25N5O7S2/c1-2-8-18(22(31)24-28-17-11-6-7-12-20(17)37-24)27-23(32)19(29-25-26-13-21(38-25)30(33)34)15-39(35,36)14-16-9-4-3-5-10-16/h3-7,9-13,18-19H,2,8,14-15H2,1H3,(H,26,29)(H,27,32)/t18?,19-/m0/s1 |
| InChIKey | DMIKDDSFWBKUAG-GGYWPGCISA-N |
| XLogP | 3.76 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|