C16H28FNO5 — CID 90845464
tert-butyl (4S)-4-(4-ethylperoxy-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 90845464) has the molecular formula C16H28FNO5 and a molecular weight of 333.40 g/mol. Its IUPAC name is tert-butyl (4S)-4-(4-ethylperoxy-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(4-ethylperoxy-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 90845464 |
| Molecular Formula | C16H28FNO5 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | tert-butyl (4S)-4-(4-ethylperoxy-3-fluorobut-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOOCC(F)=CC[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28FNO5/c1-7-21-22-10-12(17)8-9-13-11-20-16(5,6)18(13)14(19)23-15(2,3)4/h8,13H,7,9-11H2,1-6H3/t13-/m0/s1 |
| InChIKey | RDFUNQGNPKWPNM-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|