C26H44N2O6S — CID 90845474
(4S,7R,8S,9S,13R,14R,16S)-4,8,13,14-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)ethenyl]-azacyclohexadecane-2,6-dione (PubChem CID 90845474) has the molecular formula C26H44N2O6S and a molecular weight of 512.71 g/mol. Its IUPAC name is (4S,7R,8S,9S,13R,14R,16S)-4,8,13,14-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)ethenyl]-azacyclohexadecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13R,14R,16S)-4,8,13,14-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)ethenyl]-azacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 90845474 |
| Molecular Formula | C26H44N2O6S |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | (4S,7R,8S,9S,13R,14R,16S)-4,8,13,14-tetrahydroxy-5,5,7,9,13-pentamethyl-16-[2-(2-methyl-4,5-dihydro-1,3-thiazol-4-yl)ethenyl]-azacyclohexadecane-2,6-dione |
| SMILES | CC1=NC(C=C[C@@H]2C[C@@H](O)[C@](C)(O)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N2)CS1 |
| InChI | InChI=1S/C26H44N2O6S/c1-15-8-7-11-26(6,34)21(30)12-18(9-10-19-14-35-17(3)27-19)28-22(31)13-20(29)25(4,5)24(33)16(2)23(15)32/h9-10,15-16,18-21,23,29-30,32,34H,7-8,11-14H2,1-6H3,(H,28,31)/t15-,16+,18+,19?,20-,21+,23-,26+/m0/s1 |
| InChIKey | SZVXAIGQCXSYET-AKOWQPGNSA-N |
| XLogP | 2.23 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|