C12H18F6O2Si — CID 90845553
1-[ditert-butyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone (PubChem CID 90845553) has the molecular formula C12H18F6O2Si and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-[ditert-butyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[ditert-butyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 90845553 |
| Molecular Formula | C12H18F6O2Si |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[ditert-butyl-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)[Si](C(=O)C(F)(F)F)(C(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C12H18F6O2Si/c1-9(2,3)21(10(4,5)6,7(19)11(13,14)15)8(20)12(16,17)18/h1-6H3 |
| InChIKey | MMAIMTZLZHWBJP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|