About 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride
2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride (PubChem CID 90845614) has the molecular formula C9H17FO3S
and a molecular weight of 224.30 g/mol. Its IUPAC name is 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride.
Molecular Properties
| Compound Name | 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride |
| PubChem CID | 90845614 |
| Molecular Formula | C9H17FO3S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride |
| SMILES | CC1C2CCC(O2)C1C.CS(=O)(=O)F |
| InChI | InChI=1S/C8H14O.CH3FO2S/c1-5-6(2)8-4-3-7(5)9-8;1-5(2,3)4/h5-8H,3-4H2,1-2H3;1H3 |
| InChIKey | XJGNUOWXKZTYOS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride?
The IUPAC name of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride (CID 90845614) is 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride.
What is the SMILES notation for 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride?
The canonical SMILES for 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride is CC1C2CCC(O2)C1C.CS(=O)(=O)F.
What is the InChIKey of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride?
The InChIKey is XJGNUOWXKZTYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.CH3FO2S/c1-5-6(2)8-4-3-7(5)9-8;1-5(2,3)4/h5-8H,3-4H2,1-2H3;1H3.
What are the key properties of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride?
2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride has a molecular weight of 224.30 g/mol, XLogP of 1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane;methanesulfonyl fluoride is sourced from PubChem (CID 90845614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).