C10H19N3 — CID 90845799
2-N'-(2,4-dimethyl-2,3-dihydropyridin-6-yl)propane-2,2-diamine (PubChem CID 90845799) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-N'-(2,4-dimethyl-2,3-dihydropyridin-6-yl)propane-2,2-diamine.
| Compound Name | 2-N'-(2,4-dimethyl-2,3-dihydropyridin-6-yl)propane-2,2-diamine |
|---|---|
| PubChem CID | 90845799 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 2-N'-(2,4-dimethyl-2,3-dihydropyridin-6-yl)propane-2,2-diamine |
| SMILES | CC1=CC(NC(C)(C)N)=NC(C)C1 |
| InChI | InChI=1S/C10H19N3/c1-7-5-8(2)12-9(6-7)13-10(3,4)11/h6,8H,5,11H2,1-4H3,(H,12,13) |
| InChIKey | PASQKLNKFWOASU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|