C22H19BrClNO3 — CID 90846641
[4-(4-chlorophenyl)phenyl] N-[2-[2-bromo-4-(hydroxymethyl)phenyl]ethyl]carbamate (PubChem CID 90846641) has the molecular formula C22H19BrClNO3 and a molecular weight of 460.76 g/mol. Its IUPAC name is [4-(4-chlorophenyl)phenyl] N-[2-[2-bromo-4-(hydroxymethyl)phenyl]ethyl]carbamate.
| Compound Name | [4-(4-chlorophenyl)phenyl] N-[2-[2-bromo-4-(hydroxymethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 90846641 |
| Molecular Formula | C22H19BrClNO3 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | [4-(4-chlorophenyl)phenyl] N-[2-[2-bromo-4-(hydroxymethyl)phenyl]ethyl]carbamate |
| SMILES | O=C(NCCc1ccc(CO)cc1Br)Oc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H19BrClNO3/c23-21-13-15(14-26)1-2-18(21)11-12-25-22(27)28-20-9-5-17(6-10-20)16-3-7-19(24)8-4-16/h1-10,13,26H,11-12,14H2,(H,25,27) |
| InChIKey | FZRJBYALGJMWMP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |