About N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine
N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine (PubChem CID 90847172) has the molecular formula C11H28N6
and a molecular weight of 244.39 g/mol. Its IUPAC name is N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine.
Molecular Properties
| Compound Name | N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine |
| PubChem CID | 90847172 |
| Molecular Formula | C11H28N6 |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine |
| SMILES | CNCN1CCNCC1.[H]/N=C/CN(C)CNC |
| InChI | InChI=1S/C6H15N3.C5H13N3/c1-7-6-9-4-2-8-3-5-9;1-7-5-8(2)4-3-6/h7-8H,2-6H2,1H3;3,6-7H,4-5H2,1-2H3/b;6-3+ |
| InChIKey | RZGDQWIQDOQHRX-GNRCENTLSA-N |
| XLogP | -1.19 |
| TPSA | 66.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine?
The IUPAC name of N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine (CID 90847172) is N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine.
What is the SMILES notation for N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine?
The canonical SMILES for N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine is CNCN1CCNCC1.[H]/N=C/CN(C)CNC.
What is the InChIKey of N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine?
The InChIKey is RZGDQWIQDOQHRX-GNRCENTLSA-N. The full InChI is InChI=1S/C6H15N3.C5H13N3/c1-7-6-9-4-2-8-3-5-9;1-7-5-8(2)4-3-6/h7-8H,2-6H2,1H3;3,6-7H,4-5H2,1-2H3/b;6-3+.
What are the key properties of N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine?
N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine has a molecular weight of 244.39 g/mol, XLogP of -1.19, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-iminoethyl)-N,N'-dimethylmethanediamine;N-methyl-1-piperazin-1-ylmethanamine is sourced from PubChem (CID 90847172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).