C18H27N3O4 — CID 90847953
tert-butyl (4S)-4-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 90847953) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is tert-butyl (4S)-4-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 90847953 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl (4S)-4-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](Cc2ccc(C(N)=NO)cc2)COC1(C)C |
| InChI | InChI=1S/C18H27N3O4/c1-17(2,3)25-16(22)21-14(11-24-18(21,4)5)10-12-6-8-13(9-7-12)15(19)20-23/h6-9,14,23H,10-11H2,1-5H3,(H2,19,20)/t14-/m0/s1 |
| InChIKey | PLZWBFYYAUXMHL-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|