methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid

C10H11NO3S — CID 90848092

IUPACmethanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid
SMILESCO.Cc1cncc2sc(C(=O)O)cc12
InChIInChI=1S/C9H7NO2S.CH4O/c1-5-3-10-4-8-6(5)2-7(13-8)9(11)12;1-2/h2-4H,1H3,(H,11,12);2H,1H3
InChIKeyUGVUQYVUMGKSLX-UHFFFAOYSA-N
MW225.27 g/mol
LogP1.91
Rot. Bonds1

About methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid

methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid (PubChem CID 90848092) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid.

Molecular Properties

Compound Namemethanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid
PubChem CID90848092
Molecular FormulaC10H11NO3S
Molecular Weight225.27 g/mol
Exact Mass225.05
IUPAC Namemethanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid
SMILESCO.Cc1cncc2sc(C(=O)O)cc12
InChIInChI=1S/C9H7NO2S.CH4O/c1-5-3-10-4-8-6(5)2-7(13-8)9(11)12;1-2/h2-4H,1H3,(H,11,12);2H,1H3
InChIKeyUGVUQYVUMGKSLX-UHFFFAOYSA-N
XLogP1.91
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.27
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
The IUPAC name of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid (CID 90848092) is methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid.
What is the SMILES notation for methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
The canonical SMILES for methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid is CO.Cc1cncc2sc(C(=O)O)cc12.
What is the InChIKey of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
The InChIKey is UGVUQYVUMGKSLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S.CH4O/c1-5-3-10-4-8-6(5)2-7(13-8)9(11)12;1-2/h2-4H,1H3,(H,11,12);2H,1H3.
What are the key properties of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid has a molecular weight of 225.27 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 90848092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).