About methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid
methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid (PubChem CID 90848092) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid |
| PubChem CID | 90848092 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid |
| SMILES | CO.Cc1cncc2sc(C(=O)O)cc12 |
| InChI | InChI=1S/C9H7NO2S.CH4O/c1-5-3-10-4-8-6(5)2-7(13-8)9(11)12;1-2/h2-4H,1H3,(H,11,12);2H,1H3 |
| InChIKey | UGVUQYVUMGKSLX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
The IUPAC name of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid (CID 90848092) is methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid.
What is the SMILES notation for methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
The canonical SMILES for methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid is CO.Cc1cncc2sc(C(=O)O)cc12.
What is the InChIKey of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
The InChIKey is UGVUQYVUMGKSLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S.CH4O/c1-5-3-10-4-8-6(5)2-7(13-8)9(11)12;1-2/h2-4H,1H3,(H,11,12);2H,1H3.
What are the key properties of methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid?
methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid has a molecular weight of 225.27 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;4-methylthieno[2,3-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 90848092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).