C8H11F3N2O2S2 — CID 90849134
1,1,1-trifluoro-N-[(1S,2S)-2-isothiocyanatocyclohexyl]methanesulfonamide (PubChem CID 90849134) has the molecular formula C8H11F3N2O2S2 and a molecular weight of 288.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(1S,2S)-2-isothiocyanatocyclohexyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[(1S,2S)-2-isothiocyanatocyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 90849134 |
| Molecular Formula | C8H11F3N2O2S2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1,1,1-trifluoro-N-[(1S,2S)-2-isothiocyanatocyclohexyl]methanesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@@H]1N=C=S)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O2S2/c9-8(10,11)17(14,15)13-7-4-2-1-3-6(7)12-5-16/h6-7,13H,1-4H2/t6-,7-/m0/s1 |
| InChIKey | APMHMWCQWTWKMP-BQBZGAKWSA-N |
| XLogP | 1.84 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|