C24H24F3N3O2S — CID 90849496
7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-5-(trifluoromethyl)indol-1-yl]sulfonyl-1,2,3,4-tetrahydroquinoline (PubChem CID 90849496) has the molecular formula C24H24F3N3O2S and a molecular weight of 475.54 g/mol. Its IUPAC name is 7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-5-(trifluoromethyl)indol-1-yl]sulfonyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-5-(trifluoromethyl)indol-1-yl]sulfonyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 90849496 |
| Molecular Formula | C24H24F3N3O2S |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 7-[3-(2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-5-(trifluoromethyl)indol-1-yl]sulfonyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CC(c2cn(S(=O)(=O)c3ccc4c(c3)NCCC4)c3ccc(C(F)(F)F)cc23)=CCN1 |
| InChI | InChI=1S/C24H24F3N3O2S/c1-15-11-17(8-10-28-15)21-14-30(23-7-5-18(12-20(21)23)24(25,26)27)33(31,32)19-6-4-16-3-2-9-29-22(16)13-19/h4-8,12-15,28-29H,2-3,9-11H2,1H3 |
| InChIKey | INHRTIHRONRQRD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |