C13H19N — CID 90850243
ethane;(1R,5S)-1-phenyl-3-azabicyclo[3.1.0]hexane (PubChem CID 90850243) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is ethane;(1R,5S)-1-phenyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | ethane;(1R,5S)-1-phenyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 90850243 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | ethane;(1R,5S)-1-phenyl-3-azabicyclo[3.1.0]hexane |
| SMILES | CC.c1ccc([C@]23CNC[C@H]2C3)cc1 |
| InChI | InChI=1S/C11H13N.C2H6/c1-2-4-9(5-3-1)11-6-10(11)7-12-8-11;1-2/h1-5,10,12H,6-8H2;1-2H3/t10-,11+;/m1./s1 |
| InChIKey | JRQJKJBOJGLVFL-DHXVBOOMSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |