C41H30FN3O7S — CID 90850675
[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate (PubChem CID 90850675) has the molecular formula C41H30FN3O7S and a molecular weight of 727.77 g/mol. Its IUPAC name is [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate.
| Compound Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
|---|---|
| PubChem CID | 90850675 |
| Molecular Formula | C41H30FN3O7S |
| Molecular Weight | 727.77 g/mol |
| Exact Mass | 727.18 |
| IUPAC Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)Oc1c2cccnc2c(OC(c2ccccc2)c2ccccc2)c2c(O)n(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C41H30FN3O7S/c42-29-19-17-26(18-20-29)24-44-25-33-34(41(44)48)38(51-36(27-10-3-1-4-11-27)28-12-5-2-6-13-28)35-32(16-9-21-43-35)37(33)52-53(49,50)23-22-45-39(46)30-14-7-8-15-31(30)40(45)47/h1-21,25,36,48H,22-24H2 |
| InChIKey | FHTUZJRTFGNOFI-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.77 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|