C23H14ClFO3 — CID 90850726
4-[4-(3-chloro-4-fluorophenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]deca-1,6,8-triene-3,5-dione (PubChem CID 90850726) has the molecular formula C23H14ClFO3 and a molecular weight of 392.81 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-fluorophenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]deca-1,6,8-triene-3,5-dione.
| Compound Name | 4-[4-(3-chloro-4-fluorophenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]deca-1,6,8-triene-3,5-dione |
|---|---|
| PubChem CID | 90850726 |
| Molecular Formula | C23H14ClFO3 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-[4-(3-chloro-4-fluorophenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]deca-1,6,8-triene-3,5-dione |
| SMILES | Cc1cc(-c2ccc(F)c(Cl)c2)cc(C)c1C1C(=O)c2c(c3ccc2o3)C1=O |
| InChI | InChI=1S/C23H14ClFO3/c1-10-7-13(12-3-4-15(25)14(24)9-12)8-11(2)18(10)21-22(26)19-16-5-6-17(28-16)20(19)23(21)27/h3-9,21H,1-2H3 |
| InChIKey | CIEVCQUAWZGRME-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|