C15H8F3N3 — CID 90851266
2-[4-(1-cyanoethylidene)-2,3,5-trifluoro-6-prop-2-enylcyclohexa-2,5-dien-1-ylidene]propanedinitrile (PubChem CID 90851266) has the molecular formula C15H8F3N3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-[4-(1-cyanoethylidene)-2,3,5-trifluoro-6-prop-2-enylcyclohexa-2,5-dien-1-ylidene]propanedinitrile.
| Compound Name | 2-[4-(1-cyanoethylidene)-2,3,5-trifluoro-6-prop-2-enylcyclohexa-2,5-dien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 90851266 |
| Molecular Formula | C15H8F3N3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-[4-(1-cyanoethylidene)-2,3,5-trifluoro-6-prop-2-enylcyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| SMILES | C=CCc1c(F)c(=C(C)C#N)c(F)c(F)c1=C(C#N)C#N |
| InChI | InChI=1S/C15H8F3N3/c1-3-4-10-12(9(6-20)7-21)15(18)14(17)11(13(10)16)8(2)5-19/h3H,1,4H2,2H3 |
| InChIKey | WUCYXGPVKYLDPT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|