About 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol
7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 90851354) has the molecular formula C13H18BrClO2S
and a molecular weight of 353.71 g/mol. Its IUPAC name is 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol.
Molecular Properties
| Compound Name | 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol |
| PubChem CID | 90851354 |
| Molecular Formula | C13H18BrClO2S |
| Molecular Weight | 353.71 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | CS(C)(O)C(Cl)C1(O)CCc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C13H18BrClO2S/c1-18(2,17)12(15)13(16)6-5-9-3-4-11(14)7-10(9)8-13/h3-4,7,12,16-17H,5-6,8H2,1-2H3 |
| InChIKey | XUSLLLHRONKGFH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol?
The IUPAC name of 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol (CID 90851354) is 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol.
What is the SMILES notation for 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol?
The canonical SMILES for 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol is CS(C)(O)C(Cl)C1(O)CCc2ccc(Br)cc2C1.
What is the InChIKey of 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol?
The InChIKey is XUSLLLHRONKGFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrClO2S/c1-18(2,17)12(15)13(16)6-5-9-3-4-11(14)7-10(9)8-13/h3-4,7,12,16-17H,5-6,8H2,1-2H3.
What are the key properties of 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol?
7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol has a molecular weight of 353.71 g/mol, XLogP of 3.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-[chloro-[hydroxy(dimethyl)-λ4-sulfanyl]methyl]-3,4-dihydro-1H-naphthalen-2-ol is sourced from PubChem (CID 90851354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).