C21H38N2O4S — CID 90851548
3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,6-trimethylheptan-2-yloxy)ethyl]propanamide (PubChem CID 90851548) has the molecular formula C21H38N2O4S and a molecular weight of 414.61 g/mol. Its IUPAC name is 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,6-trimethylheptan-2-yloxy)ethyl]propanamide.
| Compound Name | 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,6-trimethylheptan-2-yloxy)ethyl]propanamide |
|---|---|
| PubChem CID | 90851548 |
| Molecular Formula | C21H38N2O4S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,6-trimethylheptan-2-yloxy)ethyl]propanamide |
| SMILES | CCSc1cc(O)n(CCC(=O)NCCOC(C)(C)CCC(C)C(C)C)c1O |
| InChI | InChI=1S/C21H38N2O4S/c1-7-28-17-14-19(25)23(20(17)26)12-9-18(24)22-11-13-27-21(5,6)10-8-16(4)15(2)3/h14-16,25-26H,7-13H2,1-6H3,(H,22,24) |
| InChIKey | IFRCTBPWJPUBTC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|