C22H22FNO4 — CID 90851802
4-benzyl-1-[3-(4-fluorophenyl)prop-2-enoyloxy]piperidine-4-carboxylic acid (PubChem CID 90851802) has the molecular formula C22H22FNO4 and a molecular weight of 383.42 g/mol. Its IUPAC name is 4-benzyl-1-[3-(4-fluorophenyl)prop-2-enoyloxy]piperidine-4-carboxylic acid.
| Compound Name | 4-benzyl-1-[3-(4-fluorophenyl)prop-2-enoyloxy]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 90851802 |
| Molecular Formula | C22H22FNO4 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-benzyl-1-[3-(4-fluorophenyl)prop-2-enoyloxy]piperidine-4-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(F)cc1)ON1CCC(Cc2ccccc2)(C(=O)O)CC1 |
| InChI | InChI=1S/C22H22FNO4/c23-19-9-6-17(7-10-19)8-11-20(25)28-24-14-12-22(13-15-24,21(26)27)16-18-4-2-1-3-5-18/h1-11H,12-16H2,(H,26,27) |
| InChIKey | HMMAIJLLNCMCRY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|