C15H11FN2O3 — CID 90852053
5-[(4S,7R)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-2-fluorobenzonitrile (PubChem CID 90852053) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is 5-[(4S,7R)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[(4S,7R)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 90852053 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5-[(4S,7R)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(-n2c(O)c3c(c2O)[C@H]2CC[C@@H]3O2)ccc1F |
| InChI | InChI=1S/C15H11FN2O3/c16-9-2-1-8(5-7(9)6-17)18-14(19)12-10-3-4-11(21-10)13(12)15(18)20/h1-2,5,10-11,19-20H,3-4H2/t10-,11+ |
| InChIKey | KICOHXHDTRBGDO-PHIMTYICSA-N |
| XLogP | 2.81 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |