C21H23N3O2 — CID 90852364
N-benzyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carboxamide (PubChem CID 90852364) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-benzyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carboxamide.
| Compound Name | N-benzyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carboxamide |
|---|---|
| PubChem CID | 90852364 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-benzyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC2(C=C(c3ccccc3)NO2)CC1 |
| InChI | InChI=1S/C21H23N3O2/c25-20(22-16-17-7-3-1-4-8-17)24-13-11-21(12-14-24)15-19(23-26-21)18-9-5-2-6-10-18/h1-10,15,23H,11-14,16H2,(H,22,25) |
| InChIKey | QWKPIVBJYUNESQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |