About 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine
1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 90852365) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine.
Analyze 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine (CID 90852365) is 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine is CN(C)CC(N)c1ncc[nH]1.
What is the InChIKey of 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine?
The InChIKey is PGMSAJKFEMNVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-11(2)5-6(8)7-9-3-4-10-7/h3-4,6H,5,8H2,1-2H3,(H,9,10).
What are the key properties of 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine?
1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine has a molecular weight of 154.22 g/mol, XLogP of -0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-2-yl)-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 90852365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).