About ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate
ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate (PubChem CID 90852685) has the molecular formula C10H17N3S
and a molecular weight of 211.33 g/mol. Its IUPAC name is ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate.
Molecular Properties
| Compound Name | ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate |
| PubChem CID | 90852685 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate |
| SMILES | [H]/N=C(\CC)N(C)/C(=N/C(C)C)SC#C |
| InChI | InChI=1S/C10H17N3S/c1-6-9(11)13(5)10(14-7-2)12-8(3)4/h2,8,11H,6H2,1,3-5H3/b11-9+,12-10- |
| InChIKey | DZFZZAASKZGUEM-IXIPZQGVSA-N |
| XLogP | 2.39 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate?
The IUPAC name of ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate (CID 90852685) is ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate.
What is the SMILES notation for ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate?
The canonical SMILES for ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate is [H]/N=C(\CC)N(C)/C(=N/C(C)C)SC#C.
What is the InChIKey of ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate?
The InChIKey is DZFZZAASKZGUEM-IXIPZQGVSA-N. The full InChI is InChI=1S/C10H17N3S/c1-6-9(11)13(5)10(14-7-2)12-8(3)4/h2,8,11H,6H2,1,3-5H3/b11-9+,12-10-.
What are the key properties of ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate?
ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate has a molecular weight of 211.33 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethynyl N-methyl-N-propanimidoyl-N'-propan-2-ylcarbamimidothioate is sourced from PubChem (CID 90852685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).