C30H45NO3 — CID 90852873
4'-acetyl-3',6',11,12b-tetramethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one (PubChem CID 90852873) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is 4'-acetyl-3',6',11,12b-tetramethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one.
| Compound Name | 4'-acetyl-3',6',11,12b-tetramethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 90852873 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | 4'-acetyl-3',6',11,12b-tetramethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
| SMILES | CC(=O)N1CC(C)CC2OC3(CCC4C(=C(C)C3)CC3C4CCC4CC(=O)CCC43C)C(C)C21 |
| InChI | InChI=1S/C30H45NO3/c1-17-12-27-28(31(16-17)20(4)32)19(3)30(34-27)11-9-23-24-7-6-21-13-22(33)8-10-29(21,5)26(24)14-25(23)18(2)15-30/h17,19,21,23-24,26-28H,6-16H2,1-5H3 |
| InChIKey | PDPNIPZUTUOGPN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|