C10H19NOS2 — CID 90853738
N-[1-(2,5-dihydrothiophen-3-yl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 90853738) has the molecular formula C10H19NOS2 and a molecular weight of 233.40 g/mol. Its IUPAC name is N-[1-(2,5-dihydrothiophen-3-yl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(2,5-dihydrothiophen-3-yl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90853738 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N-[1-(2,5-dihydrothiophen-3-yl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)C1=CCSC1 |
| InChI | InChI=1S/C10H19NOS2/c1-8(9-5-6-13-7-9)11-14(12)10(2,3)4/h5,8,11H,6-7H2,1-4H3 |
| InChIKey | ZQZYSPCYZIUWHL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|