C56H94N2O5 — CID 90853983
butyl 11-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-(2,2-dimethyl-3-phenylbutyl)-6-(methoxymethyl)-3,3,4,4,7,7,8,8,11-nonamethyl-10-pyridin-4-yldodecanoate (PubChem CID 90853983) has the molecular formula C56H94N2O5 and a molecular weight of 875.38 g/mol. Its IUPAC name is butyl 11-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-(2,2-dimethyl-3-phenylbutyl)-6-(methoxymethyl)-3,3,4,4,7,7,8,8,11-nonamethyl-10-pyridin-4-yldodecanoate.
| Compound Name | butyl 11-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-(2,2-dimethyl-3-phenylbutyl)-6-(methoxymethyl)-3,3,4,4,7,7,8,8,11-nonamethyl-10-pyridin-4-yldodecanoate |
|---|---|
| PubChem CID | 90853983 |
| Molecular Formula | C56H94N2O5 |
| Molecular Weight | 875.38 g/mol |
| Exact Mass | 874.72 |
| IUPAC Name | butyl 11-(2,6-diethyl-2,3,6-trimethyl-4-oxopiperidin-1-yl)oxy-2-(2,2-dimethyl-3-phenylbutyl)-6-(methoxymethyl)-3,3,4,4,7,7,8,8,11-nonamethyl-10-pyridin-4-yldodecanoate |
| SMILES | CCCCOC(=O)C(CC(C)(C)C(C)c1ccccc1)C(C)(C)C(C)(C)CC(COC)C(C)(C)C(C)(C)CC(c1ccncc1)C(C)(C)ON1C(C)(CC)CC(=O)C(C)C1(C)CC |
| InChI | InChI=1S/C56H94N2O5/c1-21-24-34-62-48(60)46(36-49(6,7)40(4)42-28-26-25-27-29-42)53(14,15)50(8,9)35-44(39-61-20)52(12,13)51(10,11)37-45(43-30-32-57-33-31-43)54(16,17)63-58-55(18,22-2)38-47(59)41(5)56(58,19)23-3/h25-33,40-41,44-46H,21-24,34-39H2,1-20H3 |
| InChIKey | BOWLYWKEQNMCHB-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.38 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|