C26H40O4 — CID 90854237
4-[1-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]cyclobut-2-ene-1-carboxylic acid (PubChem CID 90854237) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 4-[1-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]cyclobut-2-ene-1-carboxylic acid.
| Compound Name | 4-[1-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]cyclobut-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 90854237 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 4-[1-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]cyclobut-2-ene-1-carboxylic acid |
| SMILES | CC(C1C=CC1C(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H40O4/c1-14(17-4-5-18(17)24(29)30)19-6-7-20-23-21(9-11-26(19,20)3)25(2)10-8-16(27)12-15(25)13-22(23)28/h4-5,14-23,27-28H,6-13H2,1-3H3,(H,29,30) |
| InChIKey | PNWTYWQYIBAUOV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|