About N-propylideneacetamide
N-propylideneacetamide (PubChem CID 90854832) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is N-propylideneacetamide.
Molecular Properties
| Compound Name | N-propylideneacetamide |
| PubChem CID | 90854832 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | N-propylideneacetamide |
| SMILES | CC/C=N/C(C)=O |
| InChI | InChI=1S/C5H9NO/c1-3-4-6-5(2)7/h4H,3H2,1-2H3/b6-4+ |
| InChIKey | UXJKXSDITHCCJX-GQCTYLIASA-N |
| XLogP | 1.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-propylideneacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylideneacetamide?
The IUPAC name of N-propylideneacetamide (CID 90854832) is N-propylideneacetamide.
What is the SMILES notation for N-propylideneacetamide?
The canonical SMILES for N-propylideneacetamide is CC/C=N/C(C)=O.
What is the InChIKey of N-propylideneacetamide?
The InChIKey is UXJKXSDITHCCJX-GQCTYLIASA-N. The full InChI is InChI=1S/C5H9NO/c1-3-4-6-5(2)7/h4H,3H2,1-2H3/b6-4+.
What are the key properties of N-propylideneacetamide?
N-propylideneacetamide has a molecular weight of 99.13 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylideneacetamide is sourced from PubChem (CID 90854832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).