C24H33BN4O7 — CID 90854876
CID 90854876 (PubChem CID 90854876) has the molecular formula C24H33BN4O7 and a molecular weight of 500.36 g/mol.
| Compound Name | CID 90854876 |
|---|---|
| PubChem CID | 90854876 |
| Molecular Formula | C24H33BN4O7 |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)CNC(=O)C2CN(C(=O)OC(C)(C)C)CN2C(=O)C(NC(=O)OC)C(C)C)cc1 |
| InChI | InChI=1S/C24H33BN4O7/c1-14(2)19(27-22(33)35-6)21(32)29-13-28(23(34)36-24(3,4)5)12-17(29)20(31)26-11-18(30)15-7-9-16(25)10-8-15/h7-10,14,17,19H,11-13H2,1-6H3,(H,26,31)(H,27,33) |
| InChIKey | BFGYVPOFAPOOBR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|