About 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol
3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol (PubChem CID 90855438) has the molecular formula C15H28N2O2S
and a molecular weight of 300.47 g/mol. Its IUPAC name is 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol |
| PubChem CID | 90855438 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol |
| SMILES | CCSc1cc(O)n(CCCCNC(C)(C)CC)c1O |
| InChI | InChI=1S/C15H28N2O2S/c1-5-15(3,4)16-9-7-8-10-17-13(18)11-12(14(17)19)20-6-2/h11,16,18-19H,5-10H2,1-4H3 |
| InChIKey | OZIVNOHYJAROPD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol?
The IUPAC name of 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol (CID 90855438) is 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol.
What is the SMILES notation for 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol?
The canonical SMILES for 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol is CCSc1cc(O)n(CCCCNC(C)(C)CC)c1O.
What is the InChIKey of 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol?
The InChIKey is OZIVNOHYJAROPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O2S/c1-5-15(3,4)16-9-7-8-10-17-13(18)11-12(14(17)19)20-6-2/h11,16,18-19H,5-10H2,1-4H3.
What are the key properties of 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol?
3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol has a molecular weight of 300.47 g/mol, XLogP of 3.57, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanyl-1-[4-(2-methylbutan-2-ylamino)butyl]pyrrole-2,5-diol is sourced from PubChem (CID 90855438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).