C8H8N2O5 — CID 90856795
4-oxo-7,9-dihydro-6H-pyrimido[2,1-c][1,4]oxazine-2-carboperoxoic acid (PubChem CID 90856795) has the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. Its IUPAC name is 4-oxo-7,9-dihydro-6H-pyrimido[2,1-c][1,4]oxazine-2-carboperoxoic acid.
| Compound Name | 4-oxo-7,9-dihydro-6H-pyrimido[2,1-c][1,4]oxazine-2-carboperoxoic acid |
|---|---|
| PubChem CID | 90856795 |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-oxo-7,9-dihydro-6H-pyrimido[2,1-c][1,4]oxazine-2-carboperoxoic acid |
| SMILES | O=C(OO)c1cc(=O)n2c(n1)COCC2 |
| InChI | InChI=1S/C8H8N2O5/c11-7-3-5(8(12)15-13)9-6-4-14-2-1-10(6)7/h3,13H,1-2,4H2 |
| InChIKey | LRPXJQXBPZOYEV-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|