C22H15ClF4N4O — CID 90856908
N-[2-[3-chloro-4-[[4-(fluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine (PubChem CID 90856908) has the molecular formula C22H15ClF4N4O and a molecular weight of 462.83 g/mol. Its IUPAC name is N-[2-[3-chloro-4-[[4-(fluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine.
| Compound Name | N-[2-[3-chloro-4-[[4-(fluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 90856908 |
| Molecular Formula | C22H15ClF4N4O |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-[2-[3-chloro-4-[[4-(fluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine |
| SMILES | FCc1ccnc(Oc2ccc(CCNc3ncnc4c(F)cc(F)c(F)c34)cc2Cl)c1 |
| InChI | InChI=1S/C22H15ClF4N4O/c23-14-7-12(1-2-17(14)32-18-8-13(10-24)4-5-28-18)3-6-29-22-19-20(27)15(25)9-16(26)21(19)30-11-31-22/h1-2,4-5,7-9,11H,3,6,10H2,(H,29,30,31) |
| InChIKey | OGHMPCCKDXFJBT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|