C19H24F6N4O3 — CID 90857067
1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-[1-(1H-imidazol-5-ylmethyl)-1,4-diazaspiro[5.5]undecan-4-yl]ethanone (PubChem CID 90857067) has the molecular formula C19H24F6N4O3 and a molecular weight of 470.41 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-[1-(1H-imidazol-5-ylmethyl)-1,4-diazaspiro[5.5]undecan-4-yl]ethanone.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-[1-(1H-imidazol-5-ylmethyl)-1,4-diazaspiro[5.5]undecan-4-yl]ethanone |
|---|---|
| PubChem CID | 90857067 |
| Molecular Formula | C19H24F6N4O3 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-[1-(1H-imidazol-5-ylmethyl)-1,4-diazaspiro[5.5]undecan-4-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2cnc[nH]2)C2(CCCCC2)C1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O.C4F6O2/c1-13(20)18-7-8-19(10-14-9-16-12-17-14)15(11-18)5-3-2-4-6-15;5-3(6,7)1(11)2(12)4(8,9)10/h9,12H,2-8,10-11H2,1H3,(H,16,17); |
| InChIKey | GCGDDUKIVJNHQC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|