About 3-ethyl-2,9-dimethyltetradeca-4,9-diene
3-ethyl-2,9-dimethyltetradeca-4,9-diene (PubChem CID 90857494) has the molecular formula C18H34
and a molecular weight of 250.47 g/mol. Its IUPAC name is 3-ethyl-2,9-dimethyltetradeca-4,9-diene.
Molecular Properties
| Compound Name | 3-ethyl-2,9-dimethyltetradeca-4,9-diene |
| PubChem CID | 90857494 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 3-ethyl-2,9-dimethyltetradeca-4,9-diene |
| SMILES | CCCCC=C(C)CCCC=CC(CC)C(C)C |
| InChI | InChI=1S/C18H34/c1-6-8-10-13-17(5)14-11-9-12-15-18(7-2)16(3)4/h12-13,15-16,18H,6-11,14H2,1-5H3 |
| InChIKey | MFFMKMXGZFWNPA-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2,9-dimethyltetradeca-4,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,9-dimethyltetradeca-4,9-diene?
The IUPAC name of 3-ethyl-2,9-dimethyltetradeca-4,9-diene (CID 90857494) is 3-ethyl-2,9-dimethyltetradeca-4,9-diene.
What is the SMILES notation for 3-ethyl-2,9-dimethyltetradeca-4,9-diene?
The canonical SMILES for 3-ethyl-2,9-dimethyltetradeca-4,9-diene is CCCCC=C(C)CCCC=CC(CC)C(C)C.
What is the InChIKey of 3-ethyl-2,9-dimethyltetradeca-4,9-diene?
The InChIKey is MFFMKMXGZFWNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34/c1-6-8-10-13-17(5)14-11-9-12-15-18(7-2)16(3)4/h12-13,15-16,18H,6-11,14H2,1-5H3.
What are the key properties of 3-ethyl-2,9-dimethyltetradeca-4,9-diene?
3-ethyl-2,9-dimethyltetradeca-4,9-diene has a molecular weight of 250.47 g/mol, XLogP of 6.53, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,9-dimethyltetradeca-4,9-diene is sourced from PubChem (CID 90857494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).