C24H18Cl2N4O3 — CID 90858155
(1S,7S)-N-(3,5-dichlorophenyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxamide (PubChem CID 90858155) has the molecular formula C24H18Cl2N4O3 and a molecular weight of 481.34 g/mol. Its IUPAC name is (1S,7S)-N-(3,5-dichlorophenyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxamide.
| Compound Name | (1S,7S)-N-(3,5-dichlorophenyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxamide |
|---|---|
| PubChem CID | 90858155 |
| Molecular Formula | C24H18Cl2N4O3 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (1S,7S)-N-(3,5-dichlorophenyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)N1C[C@@H]2C[C@H]1c1c(O)n(-c3cccc4ccccc34)c(=O)n12 |
| InChI | InChI=1S/C24H18Cl2N4O3/c25-14-8-15(26)10-16(9-14)27-23(32)28-12-17-11-20(28)21-22(31)30(24(33)29(17)21)19-7-3-5-13-4-1-2-6-18(13)19/h1-10,17,20,31H,11-12H2,(H,27,32)/t17-,20-/m0/s1 |
| InChIKey | HKORRFBKGXPGSY-PXNSSMCTSA-N |
| XLogP | 5.34 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |