C28H28N5O+ — CID 90858156
2-[8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-4-ium-1-yl]propan-2-ol (PubChem CID 90858156) has the molecular formula C28H28N5O+ and a molecular weight of 450.57 g/mol. Its IUPAC name is 2-[8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-4-ium-1-yl]propan-2-ol.
| Compound Name | 2-[8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-4-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 90858156 |
| Molecular Formula | C28H28N5O+ |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-4-ium-1-yl]propan-2-ol |
| SMILES | CC(C)(O)n1nc[n+]2ccc3nc(-c4ccc(C5(N)CCC5)cc4)c(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C28H28N5O/c1-27(2,34)33-26-23-17-22(19-7-4-3-5-8-19)25(31-24(23)13-16-32(26)18-30-33)20-9-11-21(12-10-20)28(29)14-6-15-28/h3-5,7-13,16-18,34H,6,14-15,29H2,1-2H3/q+1 |
| InChIKey | AXLHHWMCEGMIKF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|