C19H19N5O — CID 90858289
pyrazin-2-yl-[(2-pyridin-4-yl-5,6,7,8-tetrahydroquinolin-8-yl)amino]methanol (PubChem CID 90858289) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is pyrazin-2-yl-[(2-pyridin-4-yl-5,6,7,8-tetrahydroquinolin-8-yl)amino]methanol.
| Compound Name | pyrazin-2-yl-[(2-pyridin-4-yl-5,6,7,8-tetrahydroquinolin-8-yl)amino]methanol |
|---|---|
| PubChem CID | 90858289 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | pyrazin-2-yl-[(2-pyridin-4-yl-5,6,7,8-tetrahydroquinolin-8-yl)amino]methanol |
| SMILES | OC(NC1CCCc2ccc(-c3ccncc3)nc21)c1cnccn1 |
| InChI | InChI=1S/C19H19N5O/c25-19(17-12-21-10-11-22-17)24-16-3-1-2-14-4-5-15(23-18(14)16)13-6-8-20-9-7-13/h4-12,16,19,24-25H,1-3H2 |
| InChIKey | JBHMPMHVJVPLAO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|